C12H15Br2NO — CID 62599154
N-(cyclopropylmethyl)-2-(2,6-dibromophenoxy)ethanamine (PubChem CID 62599154) has the molecular formula C12H15Br2NO and a molecular weight of 349.07 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-(2,6-dibromophenoxy)ethanamine.
| Compound Name | N-(cyclopropylmethyl)-2-(2,6-dibromophenoxy)ethanamine |
|---|---|
| PubChem CID | 62599154 |
| Molecular Formula | C12H15Br2NO |
| Molecular Weight | 349.07 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | N-(cyclopropylmethyl)-2-(2,6-dibromophenoxy)ethanamine |
| SMILES | Brc1cccc(Br)c1OCCNCC1CC1 |
| InChI | InChI=1S/C12H15Br2NO/c13-10-2-1-3-11(14)12(10)16-7-6-15-8-9-4-5-9/h1-3,9,15H,4-8H2 |
| InChIKey | QHWNJUPCYOGUSQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.07 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|