C12H17Br2NO — CID 61385418
N-[2-(2,6-dibromophenoxy)ethyl]-2-methylpropan-2-amine (PubChem CID 61385418) has the molecular formula C12H17Br2NO and a molecular weight of 351.08 g/mol. Its IUPAC name is N-[2-(2,6-dibromophenoxy)ethyl]-2-methylpropan-2-amine.
| Compound Name | N-[2-(2,6-dibromophenoxy)ethyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 61385418 |
| Molecular Formula | C12H17Br2NO |
| Molecular Weight | 351.08 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | N-[2-(2,6-dibromophenoxy)ethyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCCOc1c(Br)cccc1Br |
| InChI | InChI=1S/C12H17Br2NO/c1-12(2,3)15-7-8-16-11-9(13)5-4-6-10(11)14/h4-6,15H,7-8H2,1-3H3 |
| InChIKey | OGPKNSHFSRHQAQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.08 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|