C14H19BrF3NOS — CID 116615095
N-[[3-bromo-2-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]-2-methylpropan-2-amine (PubChem CID 116615095) has the molecular formula C14H19BrF3NOS and a molecular weight of 386.28 g/mol. Its IUPAC name is N-[[3-bromo-2-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[3-bromo-2-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 116615095 |
| Molecular Formula | C14H19BrF3NOS |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | N-[[3-bromo-2-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cccc(Br)c1OCCSC(F)(F)F |
| InChI | InChI=1S/C14H19BrF3NOS/c1-13(2,3)19-9-10-5-4-6-11(15)12(10)20-7-8-21-14(16,17)18/h4-6,19H,7-9H2,1-3H3 |
| InChIKey | XPGXSVNJFGOKGN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|