C13H17ClF3NOS — CID 116615190
N-[[3-chloro-2-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]propan-2-amine (PubChem CID 116615190) has the molecular formula C13H17ClF3NOS and a molecular weight of 327.80 g/mol. Its IUPAC name is N-[[3-chloro-2-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]propan-2-amine.
| Compound Name | N-[[3-chloro-2-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 116615190 |
| Molecular Formula | C13H17ClF3NOS |
| Molecular Weight | 327.80 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-[[3-chloro-2-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1cccc(Cl)c1OCCSC(F)(F)F |
| InChI | InChI=1S/C13H17ClF3NOS/c1-9(2)18-8-10-4-3-5-11(14)12(10)19-6-7-20-13(15,16)17/h3-5,9,18H,6-8H2,1-2H3 |
| InChIKey | LRHBETKAVYKHLP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.80 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|