C13H18F3NOS — CID 116614952
N-[[4-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]propan-2-amine (PubChem CID 116614952) has the molecular formula C13H18F3NOS and a molecular weight of 293.35 g/mol. Its IUPAC name is N-[[4-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]propan-2-amine.
| Compound Name | N-[[4-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 116614952 |
| Molecular Formula | C13H18F3NOS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | N-[[4-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccc(OCCSC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3NOS/c1-10(2)17-9-11-3-5-12(6-4-11)18-7-8-19-13(14,15)16/h3-6,10,17H,7-9H2,1-2H3 |
| InChIKey | BRZZQVGBHUSPIO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|