C17H29NO — CID 104827685
N-[(4-butoxyphenyl)methyl]-3,3-dimethylbutan-2-amine (PubChem CID 104827685) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is N-[(4-butoxyphenyl)methyl]-3,3-dimethylbutan-2-amine.
| Compound Name | N-[(4-butoxyphenyl)methyl]-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 104827685 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | N-[(4-butoxyphenyl)methyl]-3,3-dimethylbutan-2-amine |
| SMILES | CCCCOc1ccc(CNC(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H29NO/c1-6-7-12-19-16-10-8-15(9-11-16)13-18-14(2)17(3,4)5/h8-11,14,18H,6-7,12-13H2,1-5H3 |
| InChIKey | BYAWRDVOVRTAHW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|