C49H84N4O4 — CID 122226234
(2S)-2-[(4-decoxyphenyl)methylamino]-N-[5-[[(2S)-2-[(4-decoxyphenyl)methylamino]-3-methylbutanoyl]amino]pentyl]-3-methylbutanamide (PubChem CID 122226234) has the molecular formula C49H84N4O4 and a molecular weight of 793.24 g/mol. Its IUPAC name is (2S)-2-[(4-decoxyphenyl)methylamino]-N-[5-[[(2S)-2-[(4-decoxyphenyl)methylamino]-3-methylbutanoyl]amino]pentyl]-3-methylbutanamide.
| Compound Name | (2S)-2-[(4-decoxyphenyl)methylamino]-N-[5-[[(2S)-2-[(4-decoxyphenyl)methylamino]-3-methylbutanoyl]amino]pentyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 122226234 |
| Molecular Formula | C49H84N4O4 |
| Molecular Weight | 793.24 g/mol |
| Exact Mass | 792.65 |
| IUPAC Name | (2S)-2-[(4-decoxyphenyl)methylamino]-N-[5-[[(2S)-2-[(4-decoxyphenyl)methylamino]-3-methylbutanoyl]amino]pentyl]-3-methylbutanamide |
| SMILES | CCCCCCCCCCOc1ccc(CN[C@H](C(=O)NCCCCCNC(=O)[C@@H](NCc2ccc(OCCCCCCCCCC)cc2)C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C49H84N4O4/c1-7-9-11-13-15-17-19-24-36-56-44-30-26-42(27-31-44)38-52-46(40(3)4)48(54)50-34-22-21-23-35-51-49(55)47(41(5)6)53-39-43-28-32-45(33-29-43)57-37-25-20-18-16-14-12-10-8-2/h26-33,40-41,46-47,52-53H,7-25,34-39H2,1-6H3,(H,50,54)(H,51,55)/t46-,47-/m0/s1 |
| InChIKey | PWUTXBODHLTBHW-MVRBIKRMSA-N |
| XLogP | 11.06 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.24 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|