C14H20F3NO2S — CID 116614941
N-[[5-methoxy-2-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]propan-2-amine (PubChem CID 116614941) has the molecular formula C14H20F3NO2S and a molecular weight of 323.38 g/mol. Its IUPAC name is N-[[5-methoxy-2-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]propan-2-amine.
| Compound Name | N-[[5-methoxy-2-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 116614941 |
| Molecular Formula | C14H20F3NO2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-[[5-methoxy-2-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]propan-2-amine |
| SMILES | COc1ccc(OCCSC(F)(F)F)c(CNC(C)C)c1 |
| InChI | InChI=1S/C14H20F3NO2S/c1-10(2)18-9-11-8-12(19-3)4-5-13(11)20-6-7-21-14(15,16)17/h4-5,8,10,18H,6-7,9H2,1-3H3 |
| InChIKey | VESZEVOTTGLMCO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|