C15H25NO2 — CID 115623243
N-[(2,5-dimethoxyphenyl)methyl]-3,3-dimethylbutan-2-amine (PubChem CID 115623243) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methyl]-3,3-dimethylbutan-2-amine.
| Compound Name | N-[(2,5-dimethoxyphenyl)methyl]-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 115623243 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methyl]-3,3-dimethylbutan-2-amine |
| SMILES | COc1ccc(OC)c(CNC(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C15H25NO2/c1-11(15(2,3)4)16-10-12-9-13(17-5)7-8-14(12)18-6/h7-9,11,16H,10H2,1-6H3 |
| InChIKey | HMAYJMIMLTWDFS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |