C18H23NO3 — CID 39424379
N-[(2,5-dimethoxyphenyl)methyl]-4-propan-2-yloxyaniline (PubChem CID 39424379) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methyl]-4-propan-2-yloxyaniline.
| Compound Name | N-[(2,5-dimethoxyphenyl)methyl]-4-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 39424379 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methyl]-4-propan-2-yloxyaniline |
| SMILES | COc1ccc(OC)c(CNc2ccc(OC(C)C)cc2)c1 |
| InChI | InChI=1S/C18H23NO3/c1-13(2)22-16-7-5-15(6-8-16)19-12-14-11-17(20-3)9-10-18(14)21-4/h5-11,13,19H,12H2,1-4H3 |
| InChIKey | SHEVFCUXONLIKW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|