C13H15NO2S — CID 66351900
N-[(2,5-dimethoxyphenyl)methyl]thiophen-3-amine (PubChem CID 66351900) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methyl]thiophen-3-amine.
| Compound Name | N-[(2,5-dimethoxyphenyl)methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66351900 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methyl]thiophen-3-amine |
| SMILES | COc1ccc(OC)c(CNc2ccsc2)c1 |
| InChI | InChI=1S/C13H15NO2S/c1-15-12-3-4-13(16-2)10(7-12)8-14-11-5-6-17-9-11/h3-7,9,14H,8H2,1-2H3 |
| InChIKey | QJUSJLLDUULSHH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |