C12H16Br3NO — CID 63501413
2-methyl-N-[2-(2,4,6-tribromophenoxy)ethyl]propan-2-amine (PubChem CID 63501413) has the molecular formula C12H16Br3NO and a molecular weight of 429.98 g/mol. Its IUPAC name is 2-methyl-N-[2-(2,4,6-tribromophenoxy)ethyl]propan-2-amine.
| Compound Name | 2-methyl-N-[2-(2,4,6-tribromophenoxy)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 63501413 |
| Molecular Formula | C12H16Br3NO |
| Molecular Weight | 429.98 g/mol |
| Exact Mass | 426.88 |
| IUPAC Name | 2-methyl-N-[2-(2,4,6-tribromophenoxy)ethyl]propan-2-amine |
| SMILES | CC(C)(C)NCCOc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C12H16Br3NO/c1-12(2,3)16-4-5-17-11-9(14)6-8(13)7-10(11)15/h6-7,16H,4-5H2,1-3H3 |
| InChIKey | IUQQBCDZNDUVCI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.98 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|