C15H23Br2NO2 — CID 107743612
4-[2,6-dibromo-4-[(tert-butylamino)methyl]phenoxy]butan-1-ol (PubChem CID 107743612) has the molecular formula C15H23Br2NO2 and a molecular weight of 409.16 g/mol. Its IUPAC name is 4-[2,6-dibromo-4-[(tert-butylamino)methyl]phenoxy]butan-1-ol.
| Compound Name | 4-[2,6-dibromo-4-[(tert-butylamino)methyl]phenoxy]butan-1-ol |
|---|---|
| PubChem CID | 107743612 |
| Molecular Formula | C15H23Br2NO2 |
| Molecular Weight | 409.16 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | 4-[2,6-dibromo-4-[(tert-butylamino)methyl]phenoxy]butan-1-ol |
| SMILES | CC(C)(C)NCc1cc(Br)c(OCCCCO)c(Br)c1 |
| InChI | InChI=1S/C15H23Br2NO2/c1-15(2,3)18-10-11-8-12(16)14(13(17)9-11)20-7-5-4-6-19/h8-9,18-19H,4-7,10H2,1-3H3 |
| InChIKey | JIQPRWWAGRJDQB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.16 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|