C16H23Br2NO — CID 107743766
N-[[3,5-dibromo-4-(2-methylidenebutoxy)phenyl]methyl]-2-methylpropan-2-amine (PubChem CID 107743766) has the molecular formula C16H23Br2NO and a molecular weight of 405.17 g/mol. Its IUPAC name is N-[[3,5-dibromo-4-(2-methylidenebutoxy)phenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[3,5-dibromo-4-(2-methylidenebutoxy)phenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 107743766 |
| Molecular Formula | C16H23Br2NO |
| Molecular Weight | 405.17 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | N-[[3,5-dibromo-4-(2-methylidenebutoxy)phenyl]methyl]-2-methylpropan-2-amine |
| SMILES | C=C(CC)COc1c(Br)cc(CNC(C)(C)C)cc1Br |
| InChI | InChI=1S/C16H23Br2NO/c1-6-11(2)10-20-15-13(17)7-12(8-14(15)18)9-19-16(3,4)5/h7-8,19H,2,6,9-10H2,1,3-5H3 |
| InChIKey | PIXUAVOCEUQUDY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.17 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|