C14H18Br2N2O3 — CID 103067153
N-tert-butyl-2-[(2,6-dibromo-4-nitrophenoxy)methyl]prop-2-en-1-amine (PubChem CID 103067153) has the molecular formula C14H18Br2N2O3 and a molecular weight of 422.12 g/mol. Its IUPAC name is N-tert-butyl-2-[(2,6-dibromo-4-nitrophenoxy)methyl]prop-2-en-1-amine.
| Compound Name | N-tert-butyl-2-[(2,6-dibromo-4-nitrophenoxy)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 103067153 |
| Molecular Formula | C14H18Br2N2O3 |
| Molecular Weight | 422.12 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | N-tert-butyl-2-[(2,6-dibromo-4-nitrophenoxy)methyl]prop-2-en-1-amine |
| SMILES | C=C(CNC(C)(C)C)COc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C14H18Br2N2O3/c1-9(7-17-14(2,3)4)8-21-13-11(15)5-10(18(19)20)6-12(13)16/h5-6,17H,1,7-8H2,2-4H3 |
| InChIKey | VZZLASJIFHKDCA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.12 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|