C13H15Br2N3O3 — CID 62100027
4-(2,6-dibromo-4-nitrophenoxy)-2-(ethylamino)-2-methylbutanenitrile (PubChem CID 62100027) has the molecular formula C13H15Br2N3O3 and a molecular weight of 421.09 g/mol. Its IUPAC name is 4-(2,6-dibromo-4-nitrophenoxy)-2-(ethylamino)-2-methylbutanenitrile.
| Compound Name | 4-(2,6-dibromo-4-nitrophenoxy)-2-(ethylamino)-2-methylbutanenitrile |
|---|---|
| PubChem CID | 62100027 |
| Molecular Formula | C13H15Br2N3O3 |
| Molecular Weight | 421.09 g/mol |
| Exact Mass | 418.95 |
| IUPAC Name | 4-(2,6-dibromo-4-nitrophenoxy)-2-(ethylamino)-2-methylbutanenitrile |
| SMILES | CCNC(C)(C#N)CCOc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C13H15Br2N3O3/c1-3-17-13(2,8-16)4-5-21-12-10(14)6-9(18(19)20)7-11(12)15/h6-7,17H,3-5H2,1-2H3 |
| InChIKey | KFQLOKQZZCJAMU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.09 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|