C8H4Br2N2O3 — CID 53211610
2-(2,6-dibromo-4-nitrophenoxy)acetonitrile (PubChem CID 53211610) has the molecular formula C8H4Br2N2O3 and a molecular weight of 335.94 g/mol. Its IUPAC name is 2-(2,6-dibromo-4-nitrophenoxy)acetonitrile.
| Compound Name | 2-(2,6-dibromo-4-nitrophenoxy)acetonitrile |
|---|---|
| PubChem CID | 53211610 |
| Molecular Formula | C8H4Br2N2O3 |
| Molecular Weight | 335.94 g/mol |
| Exact Mass | 333.86 |
| IUPAC Name | 2-(2,6-dibromo-4-nitrophenoxy)acetonitrile |
| SMILES | N#CCOc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C8H4Br2N2O3/c9-6-3-5(12(13)14)4-7(10)8(6)15-2-1-11/h3-4H,2H2 |
| InChIKey | KNKHMLWAWGGBHX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.94 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|