C10H9Br2N3O3 — CID 62099516
2-amino-3-(2,6-dibromo-4-nitrophenoxy)-2-methylpropanenitrile (PubChem CID 62099516) has the molecular formula C10H9Br2N3O3 and a molecular weight of 379.01 g/mol. Its IUPAC name is 2-amino-3-(2,6-dibromo-4-nitrophenoxy)-2-methylpropanenitrile.
| Compound Name | 2-amino-3-(2,6-dibromo-4-nitrophenoxy)-2-methylpropanenitrile |
|---|---|
| PubChem CID | 62099516 |
| Molecular Formula | C10H9Br2N3O3 |
| Molecular Weight | 379.01 g/mol |
| Exact Mass | 376.90 |
| IUPAC Name | 2-amino-3-(2,6-dibromo-4-nitrophenoxy)-2-methylpropanenitrile |
| SMILES | CC(N)(C#N)COc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C10H9Br2N3O3/c1-10(14,4-13)5-18-9-7(11)2-6(15(16)17)3-8(9)12/h2-3H,5,14H2,1H3 |
| InChIKey | CKGGRVXVUHAMFT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.01 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|