C11H12Br2N2O5 — CID 62097654
2-amino-4-(2,6-dibromo-4-nitrophenoxy)-2-methylbutanoic acid (PubChem CID 62097654) has the molecular formula C11H12Br2N2O5 and a molecular weight of 412.03 g/mol. Its IUPAC name is 2-amino-4-(2,6-dibromo-4-nitrophenoxy)-2-methylbutanoic acid.
| Compound Name | 2-amino-4-(2,6-dibromo-4-nitrophenoxy)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 62097654 |
| Molecular Formula | C11H12Br2N2O5 |
| Molecular Weight | 412.03 g/mol |
| Exact Mass | 409.91 |
| IUPAC Name | 2-amino-4-(2,6-dibromo-4-nitrophenoxy)-2-methylbutanoic acid |
| SMILES | CC(N)(CCOc1c(Br)cc([N+](=O)[O-])cc1Br)C(=O)O |
| InChI | InChI=1S/C11H12Br2N2O5/c1-11(14,10(16)17)2-3-20-9-7(12)4-6(15(18)19)5-8(9)13/h4-5H,2-3,14H2,1H3,(H,16,17) |
| InChIKey | YXNRVWMJWCEYFO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.03 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|