C12H15Br2N3O4 — CID 62100197
3-(2,6-dibromo-4-nitrophenoxy)-2-(ethylamino)-2-methylpropanamide (PubChem CID 62100197) has the molecular formula C12H15Br2N3O4 and a molecular weight of 425.08 g/mol. Its IUPAC name is 3-(2,6-dibromo-4-nitrophenoxy)-2-(ethylamino)-2-methylpropanamide.
| Compound Name | 3-(2,6-dibromo-4-nitrophenoxy)-2-(ethylamino)-2-methylpropanamide |
|---|---|
| PubChem CID | 62100197 |
| Molecular Formula | C12H15Br2N3O4 |
| Molecular Weight | 425.08 g/mol |
| Exact Mass | 422.94 |
| IUPAC Name | 3-(2,6-dibromo-4-nitrophenoxy)-2-(ethylamino)-2-methylpropanamide |
| SMILES | CCNC(C)(COc1c(Br)cc([N+](=O)[O-])cc1Br)C(N)=O |
| InChI | InChI=1S/C12H15Br2N3O4/c1-3-16-12(2,11(15)18)6-21-10-8(13)4-7(17(19)20)5-9(10)14/h4-5,16H,3,6H2,1-2H3,(H2,15,18) |
| InChIKey | IGKUYDGTSMORHY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.08 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|