C12H15Br2NO5 — CID 63629439
1,3-dibromo-2-(2,2-diethoxyethoxy)-5-nitrobenzene (PubChem CID 63629439) has the molecular formula C12H15Br2NO5 and a molecular weight of 413.06 g/mol. Its IUPAC name is 1,3-dibromo-2-(2,2-diethoxyethoxy)-5-nitrobenzene.
| Compound Name | 1,3-dibromo-2-(2,2-diethoxyethoxy)-5-nitrobenzene |
|---|---|
| PubChem CID | 63629439 |
| Molecular Formula | C12H15Br2NO5 |
| Molecular Weight | 413.06 g/mol |
| Exact Mass | 410.93 |
| IUPAC Name | 1,3-dibromo-2-(2,2-diethoxyethoxy)-5-nitrobenzene |
| SMILES | CCOC(COc1c(Br)cc([N+](=O)[O-])cc1Br)OCC |
| InChI | InChI=1S/C12H15Br2NO5/c1-3-18-11(19-4-2)7-20-12-9(13)5-8(15(16)17)6-10(12)14/h5-6,11H,3-4,7H2,1-2H3 |
| InChIKey | XQUKTARPPGMTHT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.06 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|