C12H16FNO5 — CID 63630430
1-(2,2-diethoxyethoxy)-2-fluoro-4-nitrobenzene (PubChem CID 63630430) has the molecular formula C12H16FNO5 and a molecular weight of 273.26 g/mol. Its IUPAC name is 1-(2,2-diethoxyethoxy)-2-fluoro-4-nitrobenzene.
| Compound Name | 1-(2,2-diethoxyethoxy)-2-fluoro-4-nitrobenzene |
|---|---|
| PubChem CID | 63630430 |
| Molecular Formula | C12H16FNO5 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1-(2,2-diethoxyethoxy)-2-fluoro-4-nitrobenzene |
| SMILES | CCOC(COc1ccc([N+](=O)[O-])cc1F)OCC |
| InChI | InChI=1S/C12H16FNO5/c1-3-17-12(18-4-2)8-19-11-6-5-9(14(15)16)7-10(11)13/h5-7,12H,3-4,8H2,1-2H3 |
| InChIKey | FOYKBHUUGQSHJD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|