C13H17NO6 — CID 114459531
4-(2,2-diethoxyethoxy)-3-nitrobenzaldehyde (PubChem CID 114459531) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is 4-(2,2-diethoxyethoxy)-3-nitrobenzaldehyde.
| Compound Name | 4-(2,2-diethoxyethoxy)-3-nitrobenzaldehyde |
|---|---|
| PubChem CID | 114459531 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 4-(2,2-diethoxyethoxy)-3-nitrobenzaldehyde |
| SMILES | CCOC(COc1ccc(C=O)cc1[N+](=O)[O-])OCC |
| InChI | InChI=1S/C13H17NO6/c1-3-18-13(19-4-2)9-20-12-6-5-10(8-15)7-11(12)14(16)17/h5-8,13H,3-4,9H2,1-2H3 |
| InChIKey | FSDNBTSJMYVWRO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|