C13H18BrNO5 — CID 79842583
5-bromo-2-(2,2-diethoxyethoxy)-1-methyl-3-nitrobenzene (PubChem CID 79842583) has the molecular formula C13H18BrNO5 and a molecular weight of 348.19 g/mol. Its IUPAC name is 5-bromo-2-(2,2-diethoxyethoxy)-1-methyl-3-nitrobenzene.
| Compound Name | 5-bromo-2-(2,2-diethoxyethoxy)-1-methyl-3-nitrobenzene |
|---|---|
| PubChem CID | 79842583 |
| Molecular Formula | C13H18BrNO5 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 5-bromo-2-(2,2-diethoxyethoxy)-1-methyl-3-nitrobenzene |
| SMILES | CCOC(COc1c(C)cc(Br)cc1[N+](=O)[O-])OCC |
| InChI | InChI=1S/C13H18BrNO5/c1-4-18-12(19-5-2)8-20-13-9(3)6-10(14)7-11(13)15(16)17/h6-7,12H,4-5,8H2,1-3H3 |
| InChIKey | QNUNRGAIUZNGIY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|