C10H11BrN2O5 — CID 79844114
2-amino-3-(4-bromo-2-methyl-6-nitrophenoxy)propanoic acid (PubChem CID 79844114) has the molecular formula C10H11BrN2O5 and a molecular weight of 319.11 g/mol. Its IUPAC name is 2-amino-3-(4-bromo-2-methyl-6-nitrophenoxy)propanoic acid.
| Compound Name | 2-amino-3-(4-bromo-2-methyl-6-nitrophenoxy)propanoic acid |
|---|---|
| PubChem CID | 79844114 |
| Molecular Formula | C10H11BrN2O5 |
| Molecular Weight | 319.11 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 2-amino-3-(4-bromo-2-methyl-6-nitrophenoxy)propanoic acid |
| SMILES | Cc1cc(Br)cc([N+](=O)[O-])c1OCC(N)C(=O)O |
| InChI | InChI=1S/C10H11BrN2O5/c1-5-2-6(11)3-8(13(16)17)9(5)18-4-7(12)10(14)15/h2-3,7H,4,12H2,1H3,(H,14,15) |
| InChIKey | OZKIISLBJJVZFD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.11 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|