C13H19NO5 — CID 13416781
4-(2,2-diethoxyethoxy)-2-methyl-1-nitrobenzene (PubChem CID 13416781) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-(2,2-diethoxyethoxy)-2-methyl-1-nitrobenzene.
| Compound Name | 4-(2,2-diethoxyethoxy)-2-methyl-1-nitrobenzene |
|---|---|
| PubChem CID | 13416781 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 4-(2,2-diethoxyethoxy)-2-methyl-1-nitrobenzene |
| SMILES | CCOC(COc1ccc([N+](=O)[O-])c(C)c1)OCC |
| InChI | InChI=1S/C13H19NO5/c1-4-17-13(18-5-2)9-19-11-6-7-12(14(15)16)10(3)8-11/h6-8,13H,4-5,9H2,1-3H3 |
| InChIKey | DVVIOJPDZSADHA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|