C9H6Br2ClNO5 — CID 113398047
2-chloro-3-(2,6-dibromo-4-nitrophenoxy)propanoic acid (PubChem CID 113398047) has the molecular formula C9H6Br2ClNO5 and a molecular weight of 403.41 g/mol. Its IUPAC name is 2-chloro-3-(2,6-dibromo-4-nitrophenoxy)propanoic acid.
| Compound Name | 2-chloro-3-(2,6-dibromo-4-nitrophenoxy)propanoic acid |
|---|---|
| PubChem CID | 113398047 |
| Molecular Formula | C9H6Br2ClNO5 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 400.83 |
| IUPAC Name | 2-chloro-3-(2,6-dibromo-4-nitrophenoxy)propanoic acid |
| SMILES | O=C(O)C(Cl)COc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C9H6Br2ClNO5/c10-5-1-4(13(16)17)2-6(11)8(5)18-3-7(12)9(14)15/h1-2,7H,3H2,(H,14,15) |
| InChIKey | OHXAWCIWMBLWBC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|