C10H7Br2NO5 — CID 55065186
(E)-4-(2,6-dibromo-4-nitrophenoxy)but-2-enoic acid (PubChem CID 55065186) has the molecular formula C10H7Br2NO5 and a molecular weight of 380.98 g/mol. Its IUPAC name is (E)-4-(2,6-dibromo-4-nitrophenoxy)but-2-enoic acid.
| Compound Name | (E)-4-(2,6-dibromo-4-nitrophenoxy)but-2-enoic acid |
|---|---|
| PubChem CID | 55065186 |
| Molecular Formula | C10H7Br2NO5 |
| Molecular Weight | 380.98 g/mol |
| Exact Mass | 378.87 |
| IUPAC Name | (E)-4-(2,6-dibromo-4-nitrophenoxy)but-2-enoic acid |
| SMILES | O=C(O)/C=C/COc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C10H7Br2NO5/c11-7-4-6(13(16)17)5-8(12)10(7)18-3-1-2-9(14)15/h1-2,4-5H,3H2,(H,14,15)/b2-1+ |
| InChIKey | OQTARVOKCCFXLN-OWOJBTEDSA-N |
| XLogP | 3.14 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.98 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|