C10H10Br2N2O5 — CID 63033176
2-amino-4-(2,6-dibromo-4-nitrophenoxy)butanoic acid (PubChem CID 63033176) has the molecular formula C10H10Br2N2O5 and a molecular weight of 398.01 g/mol. Its IUPAC name is 2-amino-4-(2,6-dibromo-4-nitrophenoxy)butanoic acid.
| Compound Name | 2-amino-4-(2,6-dibromo-4-nitrophenoxy)butanoic acid |
|---|---|
| PubChem CID | 63033176 |
| Molecular Formula | C10H10Br2N2O5 |
| Molecular Weight | 398.01 g/mol |
| Exact Mass | 395.90 |
| IUPAC Name | 2-amino-4-(2,6-dibromo-4-nitrophenoxy)butanoic acid |
| SMILES | NC(CCOc1c(Br)cc([N+](=O)[O-])cc1Br)C(=O)O |
| InChI | InChI=1S/C10H10Br2N2O5/c11-6-3-5(14(17)18)4-7(12)9(6)19-2-1-8(13)10(15)16/h3-4,8H,1-2,13H2,(H,15,16) |
| InChIKey | PNYBFJIJIHAETA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.01 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|