C13H18ClN3O4 — CID 107718607
4-(2-chloro-6-nitrophenoxy)-2-(ethylamino)-2-methylbutanamide (PubChem CID 107718607) has the molecular formula C13H18ClN3O4 and a molecular weight of 315.76 g/mol. Its IUPAC name is 4-(2-chloro-6-nitrophenoxy)-2-(ethylamino)-2-methylbutanamide.
| Compound Name | 4-(2-chloro-6-nitrophenoxy)-2-(ethylamino)-2-methylbutanamide |
|---|---|
| PubChem CID | 107718607 |
| Molecular Formula | C13H18ClN3O4 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 4-(2-chloro-6-nitrophenoxy)-2-(ethylamino)-2-methylbutanamide |
| SMILES | CCNC(C)(CCOc1c(Cl)cccc1[N+](=O)[O-])C(N)=O |
| InChI | InChI=1S/C13H18ClN3O4/c1-3-16-13(2,12(15)18)7-8-21-11-9(14)5-4-6-10(11)17(19)20/h4-6,16H,3,7-8H2,1-2H3,(H2,15,18) |
| InChIKey | GCXIVQNAALLCET-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|