C11H11Cl2N3O3 — CID 62098810
2-amino-4-(2,6-dichloro-4-nitrophenoxy)-2-methylbutanenitrile (PubChem CID 62098810) has the molecular formula C11H11Cl2N3O3 and a molecular weight of 304.13 g/mol. Its IUPAC name is 2-amino-4-(2,6-dichloro-4-nitrophenoxy)-2-methylbutanenitrile.
| Compound Name | 2-amino-4-(2,6-dichloro-4-nitrophenoxy)-2-methylbutanenitrile |
|---|---|
| PubChem CID | 62098810 |
| Molecular Formula | C11H11Cl2N3O3 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 2-amino-4-(2,6-dichloro-4-nitrophenoxy)-2-methylbutanenitrile |
| SMILES | CC(N)(C#N)CCOc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C11H11Cl2N3O3/c1-11(15,6-14)2-3-19-10-8(12)4-7(16(17)18)5-9(10)13/h4-5H,2-3,15H2,1H3 |
| InChIKey | VVOHUENGCBTLGP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|