C9H9Cl2N3O4 — CID 76935361
3-(2,6-dichloro-4-nitrophenoxy)-N'-hydroxypropanimidamide (PubChem CID 76935361) has the molecular formula C9H9Cl2N3O4 and a molecular weight of 294.09 g/mol. Its IUPAC name is 3-(2,6-dichloro-4-nitrophenoxy)-N'-hydroxypropanimidamide.
| Compound Name | 3-(2,6-dichloro-4-nitrophenoxy)-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 76935361 |
| Molecular Formula | C9H9Cl2N3O4 |
| Molecular Weight | 294.09 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 3-(2,6-dichloro-4-nitrophenoxy)-N'-hydroxypropanimidamide |
| SMILES | NC(CCOc1c(Cl)cc([N+](=O)[O-])cc1Cl)=NO |
| InChI | InChI=1S/C9H9Cl2N3O4/c10-6-3-5(14(16)17)4-7(11)9(6)18-2-1-8(12)13-15/h3-4,15H,1-2H2,(H2,12,13) |
| InChIKey | VZGZRGKHUBOFRW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.09 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|