C11H13Cl2N3O3 — CID 62097780
5-(2,6-dichloro-4-nitrophenoxy)pentanimidamide (PubChem CID 62097780) has the molecular formula C11H13Cl2N3O3 and a molecular weight of 306.15 g/mol. Its IUPAC name is 5-(2,6-dichloro-4-nitrophenoxy)pentanimidamide.
| Compound Name | 5-(2,6-dichloro-4-nitrophenoxy)pentanimidamide |
|---|---|
| PubChem CID | 62097780 |
| Molecular Formula | C11H13Cl2N3O3 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 5-(2,6-dichloro-4-nitrophenoxy)pentanimidamide |
| SMILES | [H]/N=C(\N)CCCCOc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C11H13Cl2N3O3/c12-8-5-7(16(17)18)6-9(13)11(8)19-4-2-1-3-10(14)15/h5-6H,1-4H2,(H3,14,15) |
| InChIKey | SABLXTOQIXUSIQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|