C10H11Cl2N3O4 — CID 63569444
4-(2,6-dichloro-4-nitrophenoxy)butanehydrazide (PubChem CID 63569444) has the molecular formula C10H11Cl2N3O4 and a molecular weight of 308.12 g/mol. Its IUPAC name is 4-(2,6-dichloro-4-nitrophenoxy)butanehydrazide.
| Compound Name | 4-(2,6-dichloro-4-nitrophenoxy)butanehydrazide |
|---|---|
| PubChem CID | 63569444 |
| Molecular Formula | C10H11Cl2N3O4 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 4-(2,6-dichloro-4-nitrophenoxy)butanehydrazide |
| SMILES | NNC(=O)CCCOc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C10H11Cl2N3O4/c11-7-4-6(15(17)18)5-8(12)10(7)19-3-1-2-9(16)14-13/h4-5H,1-3,13H2,(H,14,16) |
| InChIKey | MWKKDHIUWCAGKD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|