C12H14Cl2N2O5 — CID 63035666
methyl 4-(2,6-dichloro-4-nitrophenoxy)-2-(methylamino)butanoate (PubChem CID 63035666) has the molecular formula C12H14Cl2N2O5 and a molecular weight of 337.16 g/mol. Its IUPAC name is methyl 4-(2,6-dichloro-4-nitrophenoxy)-2-(methylamino)butanoate.
| Compound Name | methyl 4-(2,6-dichloro-4-nitrophenoxy)-2-(methylamino)butanoate |
|---|---|
| PubChem CID | 63035666 |
| Molecular Formula | C12H14Cl2N2O5 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | methyl 4-(2,6-dichloro-4-nitrophenoxy)-2-(methylamino)butanoate |
| SMILES | CNC(CCOc1c(Cl)cc([N+](=O)[O-])cc1Cl)C(=O)OC |
| InChI | InChI=1S/C12H14Cl2N2O5/c1-15-10(12(17)20-2)3-4-21-11-8(13)5-7(16(18)19)6-9(11)14/h5-6,10,15H,3-4H2,1-2H3 |
| InChIKey | BUJQROMZQARXIO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|