C11H13Cl2N3O4 — CID 107501706
5-(4,5-dichloro-2-nitrophenoxy)pentanehydrazide (PubChem CID 107501706) has the molecular formula C11H13Cl2N3O4 and a molecular weight of 322.15 g/mol. Its IUPAC name is 5-(4,5-dichloro-2-nitrophenoxy)pentanehydrazide.
| Compound Name | 5-(4,5-dichloro-2-nitrophenoxy)pentanehydrazide |
|---|---|
| PubChem CID | 107501706 |
| Molecular Formula | C11H13Cl2N3O4 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 5-(4,5-dichloro-2-nitrophenoxy)pentanehydrazide |
| SMILES | NNC(=O)CCCCOc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13Cl2N3O4/c12-7-5-9(16(18)19)10(6-8(7)13)20-4-2-1-3-11(17)15-14/h5-6H,1-4,14H2,(H,15,17) |
| InChIKey | PREQNPQKKMPSMJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|