C14H11Cl2NO3S — CID 79406085
1,3-dichloro-5-nitro-2-(2-phenylsulfanylethoxy)benzene (PubChem CID 79406085) has the molecular formula C14H11Cl2NO3S and a molecular weight of 344.22 g/mol. Its IUPAC name is 1,3-dichloro-5-nitro-2-(2-phenylsulfanylethoxy)benzene.
| Compound Name | 1,3-dichloro-5-nitro-2-(2-phenylsulfanylethoxy)benzene |
|---|---|
| PubChem CID | 79406085 |
| Molecular Formula | C14H11Cl2NO3S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 1,3-dichloro-5-nitro-2-(2-phenylsulfanylethoxy)benzene |
| SMILES | O=[N+]([O-])c1cc(Cl)c(OCCSc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl2NO3S/c15-12-8-10(17(18)19)9-13(16)14(12)20-6-7-21-11-4-2-1-3-5-11/h1-5,8-9H,6-7H2 |
| InChIKey | PLIWGIKQQMNXQH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|