C6H4Cl2NO6P — CID 3082633
(2,6-dichloro-4-nitrophenyl) dihydrogen phosphate (PubChem CID 3082633) has the molecular formula C6H4Cl2NO6P and a molecular weight of 287.98 g/mol. Its IUPAC name is (2,6-dichloro-4-nitrophenyl) dihydrogen phosphate.
| Compound Name | (2,6-dichloro-4-nitrophenyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 3082633 |
| Molecular Formula | C6H4Cl2NO6P |
| Molecular Weight | 287.98 g/mol |
| Exact Mass | 286.92 |
| IUPAC Name | (2,6-dichloro-4-nitrophenyl) dihydrogen phosphate |
| SMILES | O=[N+]([O-])c1cc(Cl)c(OP(=O)(O)O)c(Cl)c1 |
| InChI | InChI=1S/C6H4Cl2NO6P/c7-4-1-3(9(10)11)2-5(8)6(4)15-16(12,13)14/h1-2H,(H2,12,13,14) |
| InChIKey | OBFPUWKJCNIVNM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.98 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|