C6H3Cl2NO6P- — CID 4205027
(2,6-dichloro-4-nitrophenyl) hydrogen phosphate (PubChem CID 4205027) has the molecular formula C6H3Cl2NO6P- and a molecular weight of 286.97 g/mol. Its IUPAC name is (2,6-dichloro-4-nitrophenyl) hydrogen phosphate.
| Compound Name | (2,6-dichloro-4-nitrophenyl) hydrogen phosphate |
|---|---|
| PubChem CID | 4205027 |
| Molecular Formula | C6H3Cl2NO6P- |
| Molecular Weight | 286.97 g/mol |
| Exact Mass | 285.91 |
| IUPAC Name | (2,6-dichloro-4-nitrophenyl) hydrogen phosphate |
| SMILES | O=[N+]([O-])c1cc(Cl)c(OP(=O)([O-])O)c(Cl)c1 |
| InChI | InChI=1S/C6H4Cl2NO6P/c7-4-1-3(9(10)11)2-5(8)6(4)15-16(12,13)14/h1-2H,(H2,12,13,14)/p-1 |
| InChIKey | OBFPUWKJCNIVNM-UHFFFAOYSA-M |
| XLogP | 1.74 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.97 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|