(4-nitrophenyl) hydrogen phosphate;silver

C6H5AgNO6P- — CID 173436602

IUPAC(4-nitrophenyl) hydrogen phosphate;silver
SMILESO=[N+]([O-])c1ccc(OP(=O)([O-])O)cc1.[Ag]
InChIInChI=1S/C6H6NO6P.Ag/c8-7(9)5-1-3-6(4-2-5)13-14(10,11)12;/h1-4H,(H2,10,11,12);/p-1
InChIKeyZWDLBGGEXIRISU-UHFFFAOYSA-M
MW325.95 g/mol
LogP0.43
Rot. Bonds3

About (4-nitrophenyl) hydrogen phosphate;silver

(4-nitrophenyl) hydrogen phosphate;silver (PubChem CID 173436602) has the molecular formula C6H5AgNO6P- and a molecular weight of 325.95 g/mol. Its IUPAC name is (4-nitrophenyl) hydrogen phosphate;silver.

Molecular Properties

Compound Name(4-nitrophenyl) hydrogen phosphate;silver
PubChem CID173436602
Molecular FormulaC6H5AgNO6P-
Molecular Weight325.95 g/mol
Exact Mass324.89
IUPAC Name(4-nitrophenyl) hydrogen phosphate;silver
SMILESO=[N+]([O-])c1ccc(OP(=O)([O-])O)cc1.[Ag]
InChIInChI=1S/C6H6NO6P.Ag/c8-7(9)5-1-3-6(4-2-5)13-14(10,11)12;/h1-4H,(H2,10,11,12);/p-1
InChIKeyZWDLBGGEXIRISU-UHFFFAOYSA-M
XLogP0.43
TPSA112.73 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.95
LogP ≤ 50.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (4-nitrophenyl) hydrogen phosphate;silver with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-nitrophenyl) hydrogen phosphate;silver?
The IUPAC name of (4-nitrophenyl) hydrogen phosphate;silver (CID 173436602) is (4-nitrophenyl) hydrogen phosphate;silver.
What is the SMILES notation for (4-nitrophenyl) hydrogen phosphate;silver?
The canonical SMILES for (4-nitrophenyl) hydrogen phosphate;silver is O=[N+]([O-])c1ccc(OP(=O)([O-])O)cc1.[Ag].
What is the InChIKey of (4-nitrophenyl) hydrogen phosphate;silver?
The InChIKey is ZWDLBGGEXIRISU-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6NO6P.Ag/c8-7(9)5-1-3-6(4-2-5)13-14(10,11)12;/h1-4H,(H2,10,11,12);/p-1.
What are the key properties of (4-nitrophenyl) hydrogen phosphate;silver?
(4-nitrophenyl) hydrogen phosphate;silver has a molecular weight of 325.95 g/mol, XLogP of 0.43, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl) hydrogen phosphate;silver is sourced from PubChem (CID 173436602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).