About (4-aminophenyl) hydrogen phosphate
(4-aminophenyl) hydrogen phosphate (PubChem CID 171149328) has the molecular formula C6H7NO4P-
and a molecular weight of 188.10 g/mol. Its IUPAC name is (4-aminophenyl) hydrogen phosphate.
Molecular Properties
| Compound Name | (4-aminophenyl) hydrogen phosphate |
| PubChem CID | 171149328 |
| Molecular Formula | C6H7NO4P- |
| Molecular Weight | 188.10 g/mol |
| Exact Mass | 188.01 |
| IUPAC Name | (4-aminophenyl) hydrogen phosphate |
| SMILES | Nc1ccc(OP(=O)([O-])O)cc1 |
| InChI | InChI=1S/C6H8NO4P/c7-5-1-3-6(4-2-5)11-12(8,9)10/h1-4H,7H2,(H2,8,9,10)/p-1 |
| InChIKey | FXZCCINCKDATPA-UHFFFAOYSA-M |
| XLogP | 0.11 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.10 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl) hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl) hydrogen phosphate?
The IUPAC name of (4-aminophenyl) hydrogen phosphate (CID 171149328) is (4-aminophenyl) hydrogen phosphate.
What is the SMILES notation for (4-aminophenyl) hydrogen phosphate?
The canonical SMILES for (4-aminophenyl) hydrogen phosphate is Nc1ccc(OP(=O)([O-])O)cc1.
What is the InChIKey of (4-aminophenyl) hydrogen phosphate?
The InChIKey is FXZCCINCKDATPA-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8NO4P/c7-5-1-3-6(4-2-5)11-12(8,9)10/h1-4H,7H2,(H2,8,9,10)/p-1.
What are the key properties of (4-aminophenyl) hydrogen phosphate?
(4-aminophenyl) hydrogen phosphate has a molecular weight of 188.10 g/mol, XLogP of 0.11, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl) hydrogen phosphate is sourced from PubChem (CID 171149328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).