About sodium;hydride;(4-propan-2-ylphenyl) dihydrogen phosphate
sodium;hydride;(4-propan-2-ylphenyl) dihydrogen phosphate (PubChem CID 174297750) has the molecular formula C9H14NaO4P
and a molecular weight of 240.17 g/mol. Its IUPAC name is sodium;hydride;(4-propan-2-ylphenyl) dihydrogen phosphate.
Molecular Properties
| Compound Name | sodium;hydride;(4-propan-2-ylphenyl) dihydrogen phosphate |
| PubChem CID | 174297750 |
| Molecular Formula | C9H14NaO4P |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | sodium;hydride;(4-propan-2-ylphenyl) dihydrogen phosphate |
| SMILES | CC(C)c1ccc(OP(=O)(O)O)cc1.[H-].[Na+] |
| InChI | InChI=1S/C9H13O4P.Na.H/c1-7(2)8-3-5-9(6-4-8)13-14(10,11)12;;/h3-7H,1-2H3,(H2,10,11,12);;/q;+1;-1 |
| InChIKey | VWOCNPZLMZNIGT-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;(4-propan-2-ylphenyl) dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;(4-propan-2-ylphenyl) dihydrogen phosphate?
The IUPAC name of sodium;hydride;(4-propan-2-ylphenyl) dihydrogen phosphate (CID 174297750) is sodium;hydride;(4-propan-2-ylphenyl) dihydrogen phosphate.
What is the SMILES notation for sodium;hydride;(4-propan-2-ylphenyl) dihydrogen phosphate?
The canonical SMILES for sodium;hydride;(4-propan-2-ylphenyl) dihydrogen phosphate is CC(C)c1ccc(OP(=O)(O)O)cc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;(4-propan-2-ylphenyl) dihydrogen phosphate?
The InChIKey is VWOCNPZLMZNIGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13O4P.Na.H/c1-7(2)8-3-5-9(6-4-8)13-14(10,11)12;;/h3-7H,1-2H3,(H2,10,11,12);;/q;+1;-1.
What are the key properties of sodium;hydride;(4-propan-2-ylphenyl) dihydrogen phosphate?
sodium;hydride;(4-propan-2-ylphenyl) dihydrogen phosphate has a molecular weight of 240.17 g/mol, XLogP of -0.60, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;(4-propan-2-ylphenyl) dihydrogen phosphate is sourced from PubChem (CID 174297750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).