C12H21O4P — CID 174794178
1,4-di(propan-2-yl)benzene;phosphoric acid (PubChem CID 174794178) has the molecular formula C12H21O4P and a molecular weight of 260.27 g/mol. Its IUPAC name is 1,4-di(propan-2-yl)benzene;phosphoric acid.
| Compound Name | 1,4-di(propan-2-yl)benzene;phosphoric acid |
|---|---|
| PubChem CID | 174794178 |
| Molecular Formula | C12H21O4P |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1,4-di(propan-2-yl)benzene;phosphoric acid |
| SMILES | CC(C)c1ccc(C(C)C)cc1.O=P(O)(O)O |
| InChI | InChI=1S/C12H18.H3O4P/c1-9(2)11-5-7-12(8-6-11)10(3)4;1-5(2,3)4/h5-10H,1-4H3;(H3,1,2,3,4) |
| InChIKey | JATFPFIPDHNGAJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|