About [2-methyl-1,1-bis(4-propan-2-ylphenyl)propan-2-yl] dihydrogen phosphate
[2-methyl-1,1-bis(4-propan-2-ylphenyl)propan-2-yl] dihydrogen phosphate (PubChem CID 162514629) has the molecular formula C22H31O4P
and a molecular weight of 390.46 g/mol. Its IUPAC name is [2-methyl-1,1-bis(4-propan-2-ylphenyl)propan-2-yl] dihydrogen phosphate.
Molecular Properties
| Compound Name | [2-methyl-1,1-bis(4-propan-2-ylphenyl)propan-2-yl] dihydrogen phosphate |
| PubChem CID | 162514629 |
| Molecular Formula | C22H31O4P |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | [2-methyl-1,1-bis(4-propan-2-ylphenyl)propan-2-yl] dihydrogen phosphate |
| SMILES | CC(C)c1ccc(C(c2ccc(C(C)C)cc2)C(C)(C)OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C22H31O4P/c1-15(2)17-7-11-19(12-8-17)21(22(5,6)26-27(23,24)25)20-13-9-18(10-14-20)16(3)4/h7-16,21H,1-6H3,(H2,23,24,25) |
| InChIKey | WWCRWNMRPHVQBB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-methyl-1,1-bis(4-propan-2-ylphenyl)propan-2-yl] dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-1,1-bis(4-propan-2-ylphenyl)propan-2-yl] dihydrogen phosphate?
The IUPAC name of [2-methyl-1,1-bis(4-propan-2-ylphenyl)propan-2-yl] dihydrogen phosphate (CID 162514629) is [2-methyl-1,1-bis(4-propan-2-ylphenyl)propan-2-yl] dihydrogen phosphate.
What is the SMILES notation for [2-methyl-1,1-bis(4-propan-2-ylphenyl)propan-2-yl] dihydrogen phosphate?
The canonical SMILES for [2-methyl-1,1-bis(4-propan-2-ylphenyl)propan-2-yl] dihydrogen phosphate is CC(C)c1ccc(C(c2ccc(C(C)C)cc2)C(C)(C)OP(=O)(O)O)cc1.
What is the InChIKey of [2-methyl-1,1-bis(4-propan-2-ylphenyl)propan-2-yl] dihydrogen phosphate?
The InChIKey is WWCRWNMRPHVQBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31O4P/c1-15(2)17-7-11-19(12-8-17)21(22(5,6)26-27(23,24)25)20-13-9-18(10-14-20)16(3)4/h7-16,21H,1-6H3,(H2,23,24,25).
What are the key properties of [2-methyl-1,1-bis(4-propan-2-ylphenyl)propan-2-yl] dihydrogen phosphate?
[2-methyl-1,1-bis(4-propan-2-ylphenyl)propan-2-yl] dihydrogen phosphate has a molecular weight of 390.46 g/mol, XLogP of 5.95, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-1,1-bis(4-propan-2-ylphenyl)propan-2-yl] dihydrogen phosphate is sourced from PubChem (CID 162514629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).