C21H29O4P — CID 162514643
1,2-bis(4-propan-2-ylphenyl)propan-2-yl dihydrogen phosphate (PubChem CID 162514643) has the molecular formula C21H29O4P and a molecular weight of 376.43 g/mol. Its IUPAC name is 1,2-bis(4-propan-2-ylphenyl)propan-2-yl dihydrogen phosphate.
| Compound Name | 1,2-bis(4-propan-2-ylphenyl)propan-2-yl dihydrogen phosphate |
|---|---|
| PubChem CID | 162514643 |
| Molecular Formula | C21H29O4P |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1,2-bis(4-propan-2-ylphenyl)propan-2-yl dihydrogen phosphate |
| SMILES | CC(C)c1ccc(CC(C)(OP(=O)(O)O)c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H29O4P/c1-15(2)18-8-6-17(7-9-18)14-21(5,25-26(22,23)24)20-12-10-19(11-13-20)16(3)4/h6-13,15-16H,14H2,1-5H3,(H2,22,23,24) |
| InChIKey | ALFQQXSPFKWYIY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|