C21H21O4P — CID 139025843
bis(2,3,4,5,6-pentadeuteriophenyl) (4-propan-2-ylphenyl) phosphate (PubChem CID 139025843) has the molecular formula C21H21O4P and a molecular weight of 378.43 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentadeuteriophenyl) (4-propan-2-ylphenyl) phosphate.
| Compound Name | bis(2,3,4,5,6-pentadeuteriophenyl) (4-propan-2-ylphenyl) phosphate |
|---|---|
| PubChem CID | 139025843 |
| Molecular Formula | C21H21O4P |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | bis(2,3,4,5,6-pentadeuteriophenyl) (4-propan-2-ylphenyl) phosphate |
| SMILES | [2H]c1c([2H])c([2H])c(OP(=O)(Oc2ccc(C(C)C)cc2)Oc2c([2H])c([2H])c([2H])c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C21H21O4P/c1-17(2)18-13-15-21(16-14-18)25-26(22,23-19-9-5-3-6-10-19)24-20-11-7-4-8-12-20/h3-17H,1-2H3/i3D,4D,5D,6D,7D,8D,9D,10D,11D,12D |
| InChIKey | JUHFQCKQQLMGAB-HZKWNVQXSA-N |
| XLogP | 6.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|