C30H33O10P — CID 141489530
2-[4-bis[4-(1-carboxypropyl)phenoxy]phosphoryloxyphenyl]butanoic acid (PubChem CID 141489530) has the molecular formula C30H33O10P and a molecular weight of 584.56 g/mol. Its IUPAC name is 2-[4-bis[4-(1-carboxypropyl)phenoxy]phosphoryloxyphenyl]butanoic acid.
| Compound Name | 2-[4-bis[4-(1-carboxypropyl)phenoxy]phosphoryloxyphenyl]butanoic acid |
|---|---|
| PubChem CID | 141489530 |
| Molecular Formula | C30H33O10P |
| Molecular Weight | 584.56 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | 2-[4-bis[4-(1-carboxypropyl)phenoxy]phosphoryloxyphenyl]butanoic acid |
| SMILES | CCC(C(=O)O)c1ccc(OP(=O)(Oc2ccc(C(CC)C(=O)O)cc2)Oc2ccc(C(CC)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H33O10P/c1-4-25(28(31)32)19-7-13-22(14-8-19)38-41(37,39-23-15-9-20(10-16-23)26(5-2)29(33)34)40-24-17-11-21(12-18-24)27(6-3)30(35)36/h7-18,25-27H,4-6H2,1-3H3,(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | BASYOFLZYJBGOF-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.56 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|