C15H23O4P — CID 125466729
(2R)-2-(4-butoxyphenyl)-3-dimethylphosphorylpropanoic acid (PubChem CID 125466729) has the molecular formula C15H23O4P and a molecular weight of 298.32 g/mol. Its IUPAC name is (2R)-2-(4-butoxyphenyl)-3-dimethylphosphorylpropanoic acid.
| Compound Name | (2R)-2-(4-butoxyphenyl)-3-dimethylphosphorylpropanoic acid |
|---|---|
| PubChem CID | 125466729 |
| Molecular Formula | C15H23O4P |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (2R)-2-(4-butoxyphenyl)-3-dimethylphosphorylpropanoic acid |
| SMILES | CCCCOc1ccc([C@@H](CP(C)(C)=O)C(=O)O)cc1 |
| InChI | InChI=1S/C15H23O4P/c1-4-5-10-19-13-8-6-12(7-9-13)14(15(16)17)11-20(2,3)18/h6-9,14H,4-5,10-11H2,1-3H3,(H,16,17)/t14-/m1/s1 |
| InChIKey | VIBFHINJKSHQIK-CQSZACIVSA-N |
| XLogP | 3.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|