C22H22O10 — CID 5159637
2-[4-[2-[4-(1,2-dicarboxyethyl)phenoxy]ethoxy]phenyl]butanedioic acid (PubChem CID 5159637) has the molecular formula C22H22O10 and a molecular weight of 446.41 g/mol. Its IUPAC name is 2-[4-[2-[4-(1,2-dicarboxyethyl)phenoxy]ethoxy]phenyl]butanedioic acid.
| Compound Name | 2-[4-[2-[4-(1,2-dicarboxyethyl)phenoxy]ethoxy]phenyl]butanedioic acid |
|---|---|
| PubChem CID | 5159637 |
| Molecular Formula | C22H22O10 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 2-[4-[2-[4-(1,2-dicarboxyethyl)phenoxy]ethoxy]phenyl]butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)c1ccc(OCCOc2ccc(C(CC(=O)O)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C22H22O10/c23-19(24)11-17(21(27)28)13-1-5-15(6-2-13)31-9-10-32-16-7-3-14(4-8-16)18(22(29)30)12-20(25)26/h1-8,17-18H,9-12H2,(H,23,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | HCPDOMFJPYSCGA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|