C11H12NO6+ — CID 58862356
[4-(1,2-dicarboxyethyl)phenyl]-methoxy-oxoazanium (PubChem CID 58862356) has the molecular formula C11H12NO6+ and a molecular weight of 254.22 g/mol. Its IUPAC name is [4-(1,2-dicarboxyethyl)phenyl]-methoxy-oxoazanium.
| Compound Name | [4-(1,2-dicarboxyethyl)phenyl]-methoxy-oxoazanium |
|---|---|
| PubChem CID | 58862356 |
| Molecular Formula | C11H12NO6+ |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | [4-(1,2-dicarboxyethyl)phenyl]-methoxy-oxoazanium |
| SMILES | CO[N+](=O)c1ccc(C(CC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C11H11NO6/c1-18-12(17)8-4-2-7(3-5-8)9(11(15)16)6-10(13)14/h2-5,9H,6H2,1H3,(H-,13,14,15,16)/p+1 |
| InChIKey | ISYSPGRDDVHQGR-UHFFFAOYSA-O |
| XLogP | 1.30 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|